About ethyl 2-hydroxypropanoate;heptan-2-one
ethyl 2-hydroxypropanoate;heptan-2-one (PubChem CID 18183690) has the molecular formula C12H24O4
and a molecular weight of 232.32 g/mol. Its IUPAC name is ethyl 2-hydroxypropanoate;heptan-2-one.
Molecular Properties
| Compound Name | ethyl 2-hydroxypropanoate;heptan-2-one |
| PubChem CID | 18183690 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | ethyl 2-hydroxypropanoate;heptan-2-one |
| SMILES | CCCCCC(C)=O.CCOC(=O)C(C)O |
| InChI | InChI=1S/C7H14O.C5H10O3/c1-3-4-5-6-7(2)8;1-3-8-5(7)4(2)6/h3-6H2,1-2H3;4,6H,3H2,1-2H3 |
| InChIKey | SCLRKTYKIFRKSB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-hydroxypropanoate;heptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-hydroxypropanoate;heptan-2-one?
The IUPAC name of ethyl 2-hydroxypropanoate;heptan-2-one (CID 18183690) is ethyl 2-hydroxypropanoate;heptan-2-one.
What is the SMILES notation for ethyl 2-hydroxypropanoate;heptan-2-one?
The canonical SMILES for ethyl 2-hydroxypropanoate;heptan-2-one is CCCCCC(C)=O.CCOC(=O)C(C)O.
What is the InChIKey of ethyl 2-hydroxypropanoate;heptan-2-one?
The InChIKey is SCLRKTYKIFRKSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O.C5H10O3/c1-3-4-5-6-7(2)8;1-3-8-5(7)4(2)6/h3-6H2,1-2H3;4,6H,3H2,1-2H3.
What are the key properties of ethyl 2-hydroxypropanoate;heptan-2-one?
ethyl 2-hydroxypropanoate;heptan-2-one has a molecular weight of 232.32 g/mol, XLogP of 2.09, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-hydroxypropanoate;heptan-2-one is sourced from PubChem (CID 18183690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).