C13H10F6N2O6S2 — CID 18185333
ethyl 5-[bis(trifluoromethylsulfonyl)amino]-1H-indole-2-carboxylate (PubChem CID 18185333) has the molecular formula C13H10F6N2O6S2 and a molecular weight of 468.35 g/mol. Its IUPAC name is ethyl 5-[bis(trifluoromethylsulfonyl)amino]-1H-indole-2-carboxylate.
| Compound Name | ethyl 5-[bis(trifluoromethylsulfonyl)amino]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 18185333 |
| Molecular Formula | C13H10F6N2O6S2 |
| Molecular Weight | 468.35 g/mol |
| Exact Mass | 467.99 |
| IUPAC Name | ethyl 5-[bis(trifluoromethylsulfonyl)amino]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(N(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)ccc2[nH]1 |
| InChI | InChI=1S/C13H10F6N2O6S2/c1-2-27-11(22)10-6-7-5-8(3-4-9(7)20-10)21(28(23,24)12(14,15)16)29(25,26)13(17,18)19/h3-6,20H,2H2,1H3 |
| InChIKey | NYUBXIHEZRFWKJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 113.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |