C14H17ClN2O5S — CID 57262199
ethyl 5-[3-chloropropylsulfonyl(hydroxy)amino]-1H-indole-2-carboxylate (PubChem CID 57262199) has the molecular formula C14H17ClN2O5S and a molecular weight of 360.82 g/mol. Its IUPAC name is ethyl 5-[3-chloropropylsulfonyl(hydroxy)amino]-1H-indole-2-carboxylate.
| Compound Name | ethyl 5-[3-chloropropylsulfonyl(hydroxy)amino]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 57262199 |
| Molecular Formula | C14H17ClN2O5S |
| Molecular Weight | 360.82 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | ethyl 5-[3-chloropropylsulfonyl(hydroxy)amino]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(N(O)S(=O)(=O)CCCCl)ccc2[nH]1 |
| InChI | InChI=1S/C14H17ClN2O5S/c1-2-22-14(18)13-9-10-8-11(4-5-12(10)16-13)17(19)23(20,21)7-3-6-15/h4-5,8-9,16,19H,2-3,6-7H2,1H3 |
| InChIKey | SGZGKBOAJLVRMF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 99.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.82 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|