C12H26N6O3S3 — CID 18185479
2-[2,3-bis[(1-hydrazinyl-1-oxopropan-2-yl)sulfanyl]propylsulfanyl]propanehydrazide (PubChem CID 18185479) has the molecular formula C12H26N6O3S3 and a molecular weight of 398.58 g/mol. Its IUPAC name is 2-[2,3-bis[(1-hydrazinyl-1-oxopropan-2-yl)sulfanyl]propylsulfanyl]propanehydrazide.
| Compound Name | 2-[2,3-bis[(1-hydrazinyl-1-oxopropan-2-yl)sulfanyl]propylsulfanyl]propanehydrazide |
|---|---|
| PubChem CID | 18185479 |
| Molecular Formula | C12H26N6O3S3 |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 2-[2,3-bis[(1-hydrazinyl-1-oxopropan-2-yl)sulfanyl]propylsulfanyl]propanehydrazide |
| SMILES | CC(SCC(CSC(C)C(=O)NN)SC(C)C(=O)NN)C(=O)NN |
| InChI | InChI=1S/C12H26N6O3S3/c1-6(10(19)16-13)22-4-9(24-8(3)12(21)18-15)5-23-7(2)11(20)17-14/h6-9H,4-5,13-15H2,1-3H3,(H,16,19)(H,17,20)(H,18,21) |
| InChIKey | XJUJFJZBKHQZNA-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 165.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|