C18H16ClN3 — CID 18186489
2-chloro-N-phenyl-5-(2-phenylethyl)pyrimidin-4-amine (PubChem CID 18186489) has the molecular formula C18H16ClN3 and a molecular weight of 309.80 g/mol. Its IUPAC name is 2-chloro-N-phenyl-5-(2-phenylethyl)pyrimidin-4-amine.
| Compound Name | 2-chloro-N-phenyl-5-(2-phenylethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 18186489 |
| Molecular Formula | C18H16ClN3 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-chloro-N-phenyl-5-(2-phenylethyl)pyrimidin-4-amine |
| SMILES | Clc1ncc(CCc2ccccc2)c(Nc2ccccc2)n1 |
| InChI | InChI=1S/C18H16ClN3/c19-18-20-13-15(12-11-14-7-3-1-4-8-14)17(22-18)21-16-9-5-2-6-10-16/h1-10,13H,11-12H2,(H,20,21,22) |
| InChIKey | CNQSMMNCTOBQGV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |