C18H16FN3 — CID 66764541
5-fluoro-N-phenyl-4-(2-phenylethyl)pyrimidin-2-amine (PubChem CID 66764541) has the molecular formula C18H16FN3 and a molecular weight of 293.35 g/mol. Its IUPAC name is 5-fluoro-N-phenyl-4-(2-phenylethyl)pyrimidin-2-amine.
| Compound Name | 5-fluoro-N-phenyl-4-(2-phenylethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 66764541 |
| Molecular Formula | C18H16FN3 |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 5-fluoro-N-phenyl-4-(2-phenylethyl)pyrimidin-2-amine |
| SMILES | Fc1cnc(Nc2ccccc2)nc1CCc1ccccc1 |
| InChI | InChI=1S/C18H16FN3/c19-16-13-20-18(21-15-9-5-2-6-10-15)22-17(16)12-11-14-7-3-1-4-8-14/h1-10,13H,11-12H2,(H,20,21,22) |
| InChIKey | DORNNIFSFXNWKJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |