C12H15N3O — CID 161338476
(2-anilinopyrimidin-5-yl)methanol;methane (PubChem CID 161338476) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is (2-anilinopyrimidin-5-yl)methanol;methane.
| Compound Name | (2-anilinopyrimidin-5-yl)methanol;methane |
|---|---|
| PubChem CID | 161338476 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | (2-anilinopyrimidin-5-yl)methanol;methane |
| SMILES | C.OCc1cnc(Nc2ccccc2)nc1 |
| InChI | InChI=1S/C11H11N3O.CH4/c15-8-9-6-12-11(13-7-9)14-10-4-2-1-3-5-10;/h1-7,15H,8H2,(H,12,13,14);1H4 |
| InChIKey | VMIVXDPKKKXKNY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |