C23H20FNO3 — CID 18193784
[2-(1,2-diphenylethylamino)-2-oxoethyl] 2-fluorobenzoate (PubChem CID 18193784) has the molecular formula C23H20FNO3 and a molecular weight of 377.42 g/mol. Its IUPAC name is [2-(1,2-diphenylethylamino)-2-oxoethyl] 2-fluorobenzoate.
| Compound Name | [2-(1,2-diphenylethylamino)-2-oxoethyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 18193784 |
| Molecular Formula | C23H20FNO3 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | [2-(1,2-diphenylethylamino)-2-oxoethyl] 2-fluorobenzoate |
| SMILES | O=C(COC(=O)c1ccccc1F)NC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20FNO3/c24-20-14-8-7-13-19(20)23(27)28-16-22(26)25-21(18-11-5-2-6-12-18)15-17-9-3-1-4-10-17/h1-14,21H,15-16H2,(H,25,26) |
| InChIKey | YUGXFBGJPBUFRH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |