C23H21NO5 — CID 8566042
[2-[[(1R)-1,2-diphenylethyl]amino]-2-oxoethyl] 2,4-dihydroxybenzoate (PubChem CID 8566042) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is [2-[[(1R)-1,2-diphenylethyl]amino]-2-oxoethyl] 2,4-dihydroxybenzoate.
| Compound Name | [2-[[(1R)-1,2-diphenylethyl]amino]-2-oxoethyl] 2,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 8566042 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | [2-[[(1R)-1,2-diphenylethyl]amino]-2-oxoethyl] 2,4-dihydroxybenzoate |
| SMILES | O=C(COC(=O)c1ccc(O)cc1O)N[C@H](Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H21NO5/c25-18-11-12-19(21(26)14-18)23(28)29-15-22(27)24-20(17-9-5-2-6-10-17)13-16-7-3-1-4-8-16/h1-12,14,20,25-26H,13,15H2,(H,24,27)/t20-/m1/s1 |
| InChIKey | IENOQUKDMPUSFT-HXUWFJFHSA-N |
| XLogP | 3.35 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |