C24H24N2O6S — CID 46814702
[2-(1,2-diphenylethylamino)-2-oxoethyl] 4-methoxy-3-sulfamoylbenzoate (PubChem CID 46814702) has the molecular formula C24H24N2O6S and a molecular weight of 468.53 g/mol. Its IUPAC name is [2-(1,2-diphenylethylamino)-2-oxoethyl] 4-methoxy-3-sulfamoylbenzoate.
| Compound Name | [2-(1,2-diphenylethylamino)-2-oxoethyl] 4-methoxy-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 46814702 |
| Molecular Formula | C24H24N2O6S |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | [2-(1,2-diphenylethylamino)-2-oxoethyl] 4-methoxy-3-sulfamoylbenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)NC(Cc2ccccc2)c2ccccc2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C24H24N2O6S/c1-31-21-13-12-19(15-22(21)33(25,29)30)24(28)32-16-23(27)26-20(18-10-6-3-7-11-18)14-17-8-4-2-5-9-17/h2-13,15,20H,14,16H2,1H3,(H,26,27)(H2,25,29,30) |
| InChIKey | KZRAMFCECDOZMK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |