C16H16FN5O3 — CID 18195254
N-(2-cyanoethyl)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-fluorophenyl)acetamide (PubChem CID 18195254) has the molecular formula C16H16FN5O3 and a molecular weight of 345.33 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-fluorophenyl)acetamide.
| Compound Name | N-(2-cyanoethyl)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 18195254 |
| Molecular Formula | C16H16FN5O3 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | N-(2-cyanoethyl)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-fluorophenyl)acetamide |
| SMILES | Cc1nn(CC(=O)N(CCC#N)c2ccc(F)cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16FN5O3/c1-11-16(22(24)25)12(2)21(19-11)10-15(23)20(9-3-8-18)14-6-4-13(17)5-7-14/h4-7H,3,9-10H2,1-2H3 |
| InChIKey | WZUBSECVBDDTGJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 105.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|