C22H22FN5O4 — CID 134016192
N-(3-amino-3-oxopropyl)-4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-(4-fluorophenyl)benzamide (PubChem CID 134016192) has the molecular formula C22H22FN5O4 and a molecular weight of 439.45 g/mol. Its IUPAC name is N-(3-amino-3-oxopropyl)-4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-(4-fluorophenyl)benzamide.
| Compound Name | N-(3-amino-3-oxopropyl)-4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 134016192 |
| Molecular Formula | C22H22FN5O4 |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | N-(3-amino-3-oxopropyl)-4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-(4-fluorophenyl)benzamide |
| SMILES | Cc1nn(Cc2ccc(C(=O)N(CCC(N)=O)c3ccc(F)cc3)cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H22FN5O4/c1-14-21(28(31)32)15(2)27(25-14)13-16-3-5-17(6-4-16)22(30)26(12-11-20(24)29)19-9-7-18(23)8-10-19/h3-10H,11-13H2,1-2H3,(H2,24,29) |
| InChIKey | SEBVKTQKBFJXEK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 124.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|