C15H10ClN3O5S — CID 18198894
1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl 5-chloro-2-nitrobenzoate (PubChem CID 18198894) has the molecular formula C15H10ClN3O5S and a molecular weight of 379.78 g/mol. Its IUPAC name is 1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl 5-chloro-2-nitrobenzoate.
| Compound Name | 1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl 5-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 18198894 |
| Molecular Formula | C15H10ClN3O5S |
| Molecular Weight | 379.78 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | 1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl 5-chloro-2-nitrobenzoate |
| SMILES | CC(OC(=O)c1cc(Cl)ccc1[N+](=O)[O-])c1nnc(-c2cccs2)o1 |
| InChI | InChI=1S/C15H10ClN3O5S/c1-8(13-17-18-14(24-13)12-3-2-6-25-12)23-15(20)10-7-9(16)4-5-11(10)19(21)22/h2-8H,1H3 |
| InChIKey | CJKCBONTXBPALX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.78 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|