C19H17N3O5 — CID 18201608
ethyl 2-[[4-(4-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]furan-3-carboxylate (PubChem CID 18201608) has the molecular formula C19H17N3O5 and a molecular weight of 367.36 g/mol. Its IUPAC name is ethyl 2-[[4-(4-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]furan-3-carboxylate.
| Compound Name | ethyl 2-[[4-(4-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 18201608 |
| Molecular Formula | C19H17N3O5 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | ethyl 2-[[4-(4-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]furan-3-carboxylate |
| SMILES | CCOC(=O)c1ccoc1CN1C(=O)NC(C)(c2ccc(C#N)cc2)C1=O |
| InChI | InChI=1S/C19H17N3O5/c1-3-26-16(23)14-8-9-27-15(14)11-22-17(24)19(2,21-18(22)25)13-6-4-12(10-20)5-7-13/h4-9H,3,11H2,1-2H3,(H,21,25) |
| InChIKey | QAZZMBWNJQBFMN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 112.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|