C10H11BrN2O3 — CID 18203667
[2-oxo-2-(prop-2-enylamino)ethyl] 4-bromo-1H-pyrrole-2-carboxylate (PubChem CID 18203667) has the molecular formula C10H11BrN2O3 and a molecular weight of 287.11 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylamino)ethyl] 4-bromo-1H-pyrrole-2-carboxylate.
| Compound Name | [2-oxo-2-(prop-2-enylamino)ethyl] 4-bromo-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 18203667 |
| Molecular Formula | C10H11BrN2O3 |
| Molecular Weight | 287.11 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | [2-oxo-2-(prop-2-enylamino)ethyl] 4-bromo-1H-pyrrole-2-carboxylate |
| SMILES | C=CCNC(=O)COC(=O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C10H11BrN2O3/c1-2-3-12-9(14)6-16-10(15)8-4-7(11)5-13-8/h2,4-5,13H,1,3,6H2,(H,12,14) |
| InChIKey | MHEQFBZXIODDTR-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.11 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|