C20H22N6O — CID 18206617
2-N-(2-ethylphenyl)-6-[[(E)-(2-methylphenyl)methylideneamino]oxymethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 18206617) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is 2-N-(2-ethylphenyl)-6-[[(E)-(2-methylphenyl)methylideneamino]oxymethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(2-ethylphenyl)-6-[[(E)-(2-methylphenyl)methylideneamino]oxymethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 18206617 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 2-N-(2-ethylphenyl)-6-[[(E)-(2-methylphenyl)methylideneamino]oxymethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CCc1ccccc1Nc1nc(N)nc(CO/N=C/c2ccccc2C)n1 |
| InChI | InChI=1S/C20H22N6O/c1-3-15-9-6-7-11-17(15)23-20-25-18(24-19(21)26-20)13-27-22-12-16-10-5-4-8-14(16)2/h4-12H,3,13H2,1-2H3,(H3,21,23,24,25,26)/b22-12+ |
| InChIKey | QRIAXDYPUBAVOM-WSDLNYQXSA-N |
| XLogP | 3.62 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|