C20H24N4O5S — CID 18207241
3-(4-methoxy-N-[2-oxo-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)ethyl]anilino)propanamide (PubChem CID 18207241) has the molecular formula C20H24N4O5S and a molecular weight of 432.50 g/mol. Its IUPAC name is 3-(4-methoxy-N-[2-oxo-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)ethyl]anilino)propanamide.
| Compound Name | 3-(4-methoxy-N-[2-oxo-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)ethyl]anilino)propanamide |
|---|---|
| PubChem CID | 18207241 |
| Molecular Formula | C20H24N4O5S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 3-(4-methoxy-N-[2-oxo-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)ethyl]anilino)propanamide |
| SMILES | COc1ccc(N(CCC(N)=O)CC(=O)N2CCc3cc(S(N)(=O)=O)ccc32)cc1 |
| InChI | InChI=1S/C20H24N4O5S/c1-29-16-4-2-15(3-5-16)23(10-9-19(21)25)13-20(26)24-11-8-14-12-17(30(22,27)28)6-7-18(14)24/h2-7,12H,8-11,13H2,1H3,(H2,21,25)(H2,22,27,28) |
| InChIKey | UHARKPFCRGEDNO-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 136.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|