C19H23N3O3S — CID 55864125
1-[2-(N,2,5-trimethylanilino)acetyl]-2,3-dihydroindole-5-sulfonamide (PubChem CID 55864125) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is 1-[2-(N,2,5-trimethylanilino)acetyl]-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-[2-(N,2,5-trimethylanilino)acetyl]-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 55864125 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 1-[2-(N,2,5-trimethylanilino)acetyl]-2,3-dihydroindole-5-sulfonamide |
| SMILES | Cc1ccc(C)c(N(C)CC(=O)N2CCc3cc(S(N)(=O)=O)ccc32)c1 |
| InChI | InChI=1S/C19H23N3O3S/c1-13-4-5-14(2)18(10-13)21(3)12-19(23)22-9-8-15-11-16(26(20,24)25)6-7-17(15)22/h4-7,10-11H,8-9,12H2,1-3H3,(H2,20,24,25) |
| InChIKey | JFLGGSHKZHRKOG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |