C22H27N3O3S — CID 46402686
1-[2-[benzyl(1-cyclopropylethyl)amino]acetyl]-2,3-dihydroindole-5-sulfonamide (PubChem CID 46402686) has the molecular formula C22H27N3O3S and a molecular weight of 413.54 g/mol. Its IUPAC name is 1-[2-[benzyl(1-cyclopropylethyl)amino]acetyl]-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-[2-[benzyl(1-cyclopropylethyl)amino]acetyl]-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 46402686 |
| Molecular Formula | C22H27N3O3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 1-[2-[benzyl(1-cyclopropylethyl)amino]acetyl]-2,3-dihydroindole-5-sulfonamide |
| SMILES | CC(C1CC1)N(CC(=O)N1CCc2cc(S(N)(=O)=O)ccc21)Cc1ccccc1 |
| InChI | InChI=1S/C22H27N3O3S/c1-16(18-7-8-18)24(14-17-5-3-2-4-6-17)15-22(26)25-12-11-19-13-20(29(23,27)28)9-10-21(19)25/h2-6,9-10,13,16,18H,7-8,11-12,14-15H2,1H3,(H2,23,27,28) |
| InChIKey | JDENFMONUOEENZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |