C34H47N3O4 — CID 18216035
tert-butyl N-[1-[butyl-[2-(cyclohexylamino)-1-(3-ethenylphenyl)-2-oxoethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 18216035) has the molecular formula C34H47N3O4 and a molecular weight of 561.77 g/mol. Its IUPAC name is tert-butyl N-[1-[butyl-[2-(cyclohexylamino)-1-(3-ethenylphenyl)-2-oxoethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[butyl-[2-(cyclohexylamino)-1-(3-ethenylphenyl)-2-oxoethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18216035 |
| Molecular Formula | C34H47N3O4 |
| Molecular Weight | 561.77 g/mol |
| Exact Mass | 561.36 |
| IUPAC Name | tert-butyl N-[1-[butyl-[2-(cyclohexylamino)-1-(3-ethenylphenyl)-2-oxoethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | C=Cc1cccc(C(C(=O)NC2CCCCC2)N(CCCC)C(=O)C(Cc2ccccc2)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C34H47N3O4/c1-6-8-22-37(32(39)29(24-26-16-11-9-12-17-26)36-33(40)41-34(3,4)5)30(27-19-15-18-25(7-2)23-27)31(38)35-28-20-13-10-14-21-28/h7,9,11-12,15-19,23,28-30H,2,6,8,10,13-14,20-22,24H2,1,3-5H3,(H,35,38)(H,36,40) |
| InChIKey | WNKWKKSOSGXRRO-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.77 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |