C14H25N3O7 — CID 18232522
2-[[2-[(2-amino-3-methylbutanoyl)amino]-3-hydroxybutanoyl]amino]pentanedioic acid (PubChem CID 18232522) has the molecular formula C14H25N3O7 and a molecular weight of 347.37 g/mol. Its IUPAC name is 2-[[2-[(2-amino-3-methylbutanoyl)amino]-3-hydroxybutanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[(2-amino-3-methylbutanoyl)amino]-3-hydroxybutanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18232522 |
| Molecular Formula | C14H25N3O7 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 2-[[2-[(2-amino-3-methylbutanoyl)amino]-3-hydroxybutanoyl]amino]pentanedioic acid |
| SMILES | CC(C)C(N)C(=O)NC(C(=O)NC(CCC(=O)O)C(=O)O)C(C)O |
| InChI | InChI=1S/C14H25N3O7/c1-6(2)10(15)12(21)17-11(7(3)18)13(22)16-8(14(23)24)4-5-9(19)20/h6-8,10-11,18H,4-5,15H2,1-3H3,(H,16,22)(H,17,21)(H,19,20)(H,23,24) |
| InChIKey | UVHFONIHVHLDDQ-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 179.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |