C15H26N4O8 — CID 18238934
2-[2-[[2-(2-aminopropanoylamino)-3-hydroxybutanoyl]amino]propanoylamino]pentanedioic acid (PubChem CID 18238934) has the molecular formula C15H26N4O8 and a molecular weight of 390.39 g/mol. Its IUPAC name is 2-[2-[[2-(2-aminopropanoylamino)-3-hydroxybutanoyl]amino]propanoylamino]pentanedioic acid.
| Compound Name | 2-[2-[[2-(2-aminopropanoylamino)-3-hydroxybutanoyl]amino]propanoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 18238934 |
| Molecular Formula | C15H26N4O8 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 2-[2-[[2-(2-aminopropanoylamino)-3-hydroxybutanoyl]amino]propanoylamino]pentanedioic acid |
| SMILES | CC(N)C(=O)NC(C(=O)NC(C)C(=O)NC(CCC(=O)O)C(=O)O)C(C)O |
| InChI | InChI=1S/C15H26N4O8/c1-6(16)12(23)19-11(8(3)20)14(25)17-7(2)13(24)18-9(15(26)27)4-5-10(21)22/h6-9,11,20H,4-5,16H2,1-3H3,(H,17,25)(H,18,24)(H,19,23)(H,21,22)(H,26,27) |
| InChIKey | HAKNBEXQFVTGPX-UHFFFAOYSA-N |
| XLogP | -2.86 |
| TPSA | 208.15 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |