C24H33N5O7 — CID 18234123
2-[[2-[[2-(2-aminopropanoylamino)-3-carboxypropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoic acid (PubChem CID 18234123) has the molecular formula C24H33N5O7 and a molecular weight of 503.56 g/mol. Its IUPAC name is 2-[[2-[[2-(2-aminopropanoylamino)-3-carboxypropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-(2-aminopropanoylamino)-3-carboxypropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18234123 |
| Molecular Formula | C24H33N5O7 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | 2-[[2-[[2-(2-aminopropanoylamino)-3-carboxypropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(CC(=O)O)NC(=O)C(C)N)C(=O)O |
| InChI | InChI=1S/C24H33N5O7/c1-4-12(2)20(24(35)36)29-23(34)17(9-14-11-26-16-8-6-5-7-15(14)16)28-22(33)18(10-19(30)31)27-21(32)13(3)25/h5-8,11-13,17-18,20,26H,4,9-10,25H2,1-3H3,(H,27,32)(H,28,33)(H,29,34)(H,30,31)(H,35,36) |
| InChIKey | SZUMWJJHGVOBRF-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 203.71 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |