C26H35N5O9 — CID 18248848
2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-4-carboxybutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoic acid (PubChem CID 18248848) has the molecular formula C26H35N5O9 and a molecular weight of 561.59 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-4-carboxybutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-4-carboxybutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18248848 |
| Molecular Formula | C26H35N5O9 |
| Molecular Weight | 561.59 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-4-carboxybutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(CCC(=O)O)NC(=O)C(N)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C26H35N5O9/c1-3-13(2)22(26(39)40)31-25(38)19(10-14-12-28-17-7-5-4-6-15(14)17)30-24(37)18(8-9-20(32)33)29-23(36)16(27)11-21(34)35/h4-7,12-13,16,18-19,22,28H,3,8-11,27H2,1-2H3,(H,29,36)(H,30,37)(H,31,38)(H,32,33)(H,34,35)(H,39,40) |
| InChIKey | QIARJBVEROMSSP-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 241.01 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.59 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |