C28H41N5O7 — CID 22699583
2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoyl]amino]-3-methylpentanoic acid (PubChem CID 22699583) has the molecular formula C28H41N5O7 and a molecular weight of 559.66 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 22699583 |
| Molecular Formula | C28H41N5O7 |
| Molecular Weight | 559.66 g/mol |
| Exact Mass | 559.30 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CC(C)C)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C28H41N5O7/c1-5-16(4)24(28(39)40)33-27(38)21(12-15(2)3)32-26(37)22(31-25(36)19(29)10-11-23(34)35)13-17-14-30-20-9-7-6-8-18(17)20/h6-9,14-16,19,21-22,24,30H,5,10-13,29H2,1-4H3,(H,31,36)(H,32,37)(H,33,38)(H,34,35)(H,39,40) |
| InChIKey | CZFUMDFJTCCXSL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 203.71 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.66 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |