C26H37N5O8 — CID 22699703
2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-3-methylpentanoic acid (PubChem CID 22699703) has the molecular formula C26H37N5O8 and a molecular weight of 547.61 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 22699703 |
| Molecular Formula | C26H37N5O8 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CCC(=O)O)C(C)O)C(=O)O |
| InChI | InChI=1S/C26H37N5O8/c1-4-13(2)21(26(38)39)30-25(37)22(14(3)32)31-24(36)19(29-23(35)17(27)9-10-20(33)34)11-15-12-28-18-8-6-5-7-16(15)18/h5-8,12-14,17,19,21-22,28,32H,4,9-11,27H2,1-3H3,(H,29,35)(H,30,37)(H,31,36)(H,33,34)(H,38,39) |
| InChIKey | GHAWJJVABYVICW-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 223.94 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |