C25H35N5O7 — CID 18234916
2-[[2-[[2-(2-aminopropanoylamino)-4-carboxybutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoic acid (PubChem CID 18234916) has the molecular formula C25H35N5O7 and a molecular weight of 517.58 g/mol. Its IUPAC name is 2-[[2-[[2-(2-aminopropanoylamino)-4-carboxybutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-(2-aminopropanoylamino)-4-carboxybutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18234916 |
| Molecular Formula | C25H35N5O7 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | 2-[[2-[[2-(2-aminopropanoylamino)-4-carboxybutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(CCC(=O)O)NC(=O)C(C)N)C(=O)O |
| InChI | InChI=1S/C25H35N5O7/c1-4-13(2)21(25(36)37)30-24(35)19(11-15-12-27-17-8-6-5-7-16(15)17)29-23(34)18(9-10-20(31)32)28-22(33)14(3)26/h5-8,12-14,18-19,21,27H,4,9-11,26H2,1-3H3,(H,28,33)(H,29,34)(H,30,35)(H,31,32)(H,36,37) |
| InChIKey | NWRWWZXEMHYZIR-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 203.71 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |