C21H29N5O6S — CID 18254841
2-[[2-[2-[(2-amino-3-sulfanylpropanoyl)amino]propanoylamino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 18254841) has the molecular formula C21H29N5O6S and a molecular weight of 479.56 g/mol. Its IUPAC name is 2-[[2-[2-[(2-amino-3-sulfanylpropanoyl)amino]propanoylamino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[2-[(2-amino-3-sulfanylpropanoyl)amino]propanoylamino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 18254841 |
| Molecular Formula | C21H29N5O6S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 2-[[2-[2-[(2-amino-3-sulfanylpropanoyl)amino]propanoylamino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(NC(=O)C(N)CS)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C21H29N5O6S/c1-10(24-19(29)14(22)9-33)18(28)25-16(20(30)26-17(11(2)27)21(31)32)7-12-8-23-15-6-4-3-5-13(12)15/h3-6,8,10-11,14,16-17,23,27,33H,7,9,22H2,1-2H3,(H,24,29)(H,25,28)(H,26,30)(H,31,32) |
| InChIKey | LHHFGLVSQJBSEY-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 186.64 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|