C13H23N3O2 — CID 18274056
ethyl (E)-2-cyano-3-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]prop-2-enoate (PubChem CID 18274056) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]prop-2-enoate |
|---|---|
| PubChem CID | 18274056 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | ethyl (E)-2-cyano-3-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/NCC(C)(C)CN(C)C |
| InChI | InChI=1S/C13H23N3O2/c1-6-18-12(17)11(7-14)8-15-9-13(2,3)10-16(4)5/h8,15H,6,9-10H2,1-5H3/b11-8+ |
| InChIKey | SFXFKDDPPPKXEJ-DHZHZOJOSA-N |
| XLogP | 1.13 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|