C13H23N3O2 — CID 8811574
ethyl (2S)-2-cyano-3-[3-(dimethylamino)-2,2-dimethylpropyl]iminopropanoate (PubChem CID 8811574) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is ethyl (2S)-2-cyano-3-[3-(dimethylamino)-2,2-dimethylpropyl]iminopropanoate.
| Compound Name | ethyl (2S)-2-cyano-3-[3-(dimethylamino)-2,2-dimethylpropyl]iminopropanoate |
|---|---|
| PubChem CID | 8811574 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | ethyl (2S)-2-cyano-3-[3-(dimethylamino)-2,2-dimethylpropyl]iminopropanoate |
| SMILES | CCOC(=O)[C@H](C#N)/C=N/CC(C)(C)CN(C)C |
| InChI | InChI=1S/C13H23N3O2/c1-6-18-12(17)11(7-14)8-15-9-13(2,3)10-16(4)5/h8,11H,6,9-10H2,1-5H3/b15-8+/t11-/m1/s1 |
| InChIKey | HCTFXOGTNGHJHQ-OXFWXOROSA-N |
| XLogP | 1.35 |
| TPSA | 65.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|