C13H22N3O2+ — CID 8811954
ethyl 2-cyano-3-[[(2R)-1-ethylpyrrolidin-1-ium-2-yl]methylimino]propanoate (PubChem CID 8811954) has the molecular formula C13H22N3O2+ and a molecular weight of 252.34 g/mol. Its IUPAC name is ethyl 2-cyano-3-[[(2R)-1-ethylpyrrolidin-1-ium-2-yl]methylimino]propanoate.
| Compound Name | ethyl 2-cyano-3-[[(2R)-1-ethylpyrrolidin-1-ium-2-yl]methylimino]propanoate |
|---|---|
| PubChem CID | 8811954 |
| Molecular Formula | C13H22N3O2+ |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | ethyl 2-cyano-3-[[(2R)-1-ethylpyrrolidin-1-ium-2-yl]methylimino]propanoate |
| SMILES | CCOC(=O)C(C#N)/C=N/C[C@H]1CCC[NH+]1CC |
| InChI | InChI=1S/C13H21N3O2/c1-3-16-7-5-6-12(16)10-15-9-11(8-14)13(17)18-4-2/h9,11-12H,3-7,10H2,1-2H3/p+1/b15-9+/t11?,12-/m1/s1 |
| InChIKey | LIOVRYUNKJNVPC-HNGZXATOSA-O |
| XLogP | -0.17 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|