C15H16F2N2O3 — CID 8821687
ethyl (2S)-2-cyano-3-[2-[4-(difluoromethoxy)phenyl]ethylimino]propanoate (PubChem CID 8821687) has the molecular formula C15H16F2N2O3 and a molecular weight of 310.30 g/mol. Its IUPAC name is ethyl (2S)-2-cyano-3-[2-[4-(difluoromethoxy)phenyl]ethylimino]propanoate.
| Compound Name | ethyl (2S)-2-cyano-3-[2-[4-(difluoromethoxy)phenyl]ethylimino]propanoate |
|---|---|
| PubChem CID | 8821687 |
| Molecular Formula | C15H16F2N2O3 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | ethyl (2S)-2-cyano-3-[2-[4-(difluoromethoxy)phenyl]ethylimino]propanoate |
| SMILES | CCOC(=O)[C@H](C#N)/C=N/CCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C15H16F2N2O3/c1-2-21-14(20)12(9-18)10-19-8-7-11-3-5-13(6-4-11)22-15(16)17/h3-6,10,12,15H,2,7-8H2,1H3/b19-10+/t12-/m1/s1 |
| InChIKey | AEQWRGRQKFJDOY-AINDZBIGSA-N |
| XLogP | 2.60 |
| TPSA | 71.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|