C20H13ClFN3O2S — CID 18281820
(2-chloro-5-methylphenyl) 1-(3-fluorophenyl)-5-thiophen-2-yl-1,2,4-triazole-3-carboxylate (PubChem CID 18281820) has the molecular formula C20H13ClFN3O2S and a molecular weight of 413.86 g/mol. Its IUPAC name is (2-chloro-5-methylphenyl) 1-(3-fluorophenyl)-5-thiophen-2-yl-1,2,4-triazole-3-carboxylate.
| Compound Name | (2-chloro-5-methylphenyl) 1-(3-fluorophenyl)-5-thiophen-2-yl-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 18281820 |
| Molecular Formula | C20H13ClFN3O2S |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | (2-chloro-5-methylphenyl) 1-(3-fluorophenyl)-5-thiophen-2-yl-1,2,4-triazole-3-carboxylate |
| SMILES | Cc1ccc(Cl)c(OC(=O)c2nc(-c3cccs3)n(-c3cccc(F)c3)n2)c1 |
| InChI | InChI=1S/C20H13ClFN3O2S/c1-12-7-8-15(21)16(10-12)27-20(26)18-23-19(17-6-3-9-28-17)25(24-18)14-5-2-4-13(22)11-14/h2-11H,1H3 |
| InChIKey | GGWZHNMHOFBWBP-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|