About [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 2-(2-methoxy-4-methylphenoxy)acetate
[3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 2-(2-methoxy-4-methylphenoxy)acetate (PubChem CID 18283537) has the molecular formula C23H23N3O5
and a molecular weight of 421.45 g/mol. Its IUPAC name is [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 2-(2-methoxy-4-methylphenoxy)acetate.
Molecular Properties
| Compound Name | [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 2-(2-methoxy-4-methylphenoxy)acetate |
| PubChem CID | 18283537 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 2-(2-methoxy-4-methylphenoxy)acetate |
| SMILES | COc1cc(C)ccc1OCC(=O)OCC(=O)C(C#N)=C1N(C)c2ccccc2N1C |
| InChI | InChI=1S/C23H23N3O5/c1-15-9-10-20(21(11-15)29-4)30-14-22(28)31-13-19(27)16(12-24)23-25(2)17-7-5-6-8-18(17)26(23)3/h5-11H,13-14H2,1-4H3 |
| InChIKey | ZZCGHFGUSGFSLW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 92.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 2-(2-methoxy-4-methylphenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 2-(2-methoxy-4-methylphenoxy)acetate?
The IUPAC name of [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 2-(2-methoxy-4-methylphenoxy)acetate (CID 18283537) is [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 2-(2-methoxy-4-methylphenoxy)acetate.
What is the SMILES notation for [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 2-(2-methoxy-4-methylphenoxy)acetate?
The canonical SMILES for [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 2-(2-methoxy-4-methylphenoxy)acetate is COc1cc(C)ccc1OCC(=O)OCC(=O)C(C#N)=C1N(C)c2ccccc2N1C.
What is the InChIKey of [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 2-(2-methoxy-4-methylphenoxy)acetate?
The InChIKey is ZZCGHFGUSGFSLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23N3O5/c1-15-9-10-20(21(11-15)29-4)30-14-22(28)31-13-19(27)16(12-24)23-25(2)17-7-5-6-8-18(17)26(23)3/h5-11H,13-14H2,1-4H3.
What are the key properties of [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 2-(2-methoxy-4-methylphenoxy)acetate?
[3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 2-(2-methoxy-4-methylphenoxy)acetate has a molecular weight of 421.45 g/mol, XLogP of 2.82, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 2-(2-methoxy-4-methylphenoxy)acetate is sourced from PubChem (CID 18283537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).