C21H26N2O4 — CID 18285096
[1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] (E)-3-(2-ethoxyphenyl)prop-2-enoate (PubChem CID 18285096) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is [1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] (E)-3-(2-ethoxyphenyl)prop-2-enoate.
| Compound Name | [1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] (E)-3-(2-ethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 18285096 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | [1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] (E)-3-(2-ethoxyphenyl)prop-2-enoate |
| SMILES | CCOc1ccccc1/C=C/C(=O)OC(C)C(=O)NC1(C#N)CCCCC1 |
| InChI | InChI=1S/C21H26N2O4/c1-3-26-18-10-6-5-9-17(18)11-12-19(24)27-16(2)20(25)23-21(15-22)13-7-4-8-14-21/h5-6,9-12,16H,3-4,7-8,13-14H2,1-2H3,(H,23,25)/b12-11+ |
| InChIKey | ATLDWLLPIKXABZ-VAWYXSNFSA-N |
| XLogP | 3.37 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|