C24H26N2O4S — CID 18285823
[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 2-benzamido-4-methylsulfanylbutanoate (PubChem CID 18285823) has the molecular formula C24H26N2O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 2-benzamido-4-methylsulfanylbutanoate.
| Compound Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 2-benzamido-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 18285823 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 2-benzamido-4-methylsulfanylbutanoate |
| SMILES | CCc1cccc2c(C(=O)COC(=O)C(CCSC)NC(=O)c3ccccc3)c[nH]c12 |
| InChI | InChI=1S/C24H26N2O4S/c1-3-16-10-7-11-18-19(14-25-22(16)18)21(27)15-30-24(29)20(12-13-31-2)26-23(28)17-8-5-4-6-9-17/h4-11,14,20,25H,3,12-13,15H2,1-2H3,(H,26,28) |
| InChIKey | LHRZRGNCOILHNI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |