C20H20N4O2S2 — CID 18290547
N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-1-(3-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 18290547) has the molecular formula C20H20N4O2S2 and a molecular weight of 412.54 g/mol. Its IUPAC name is N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-1-(3-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-1-(3-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 18290547 |
| Molecular Formula | C20H20N4O2S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-1-(3-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CSc1cccc(N2CC(C(=O)N/N=c3\sc4ccccc4n3C)CC2=O)c1 |
| InChI | InChI=1S/C20H20N4O2S2/c1-23-16-8-3-4-9-17(16)28-20(23)22-21-19(26)13-10-18(25)24(12-13)14-6-5-7-15(11-14)27-2/h3-9,11,13H,10,12H2,1-2H3,(H,21,26)/b22-20- |
| InChIKey | IQDAATWGIGUAHA-XDOYNYLZSA-N |
| XLogP | 2.95 |
| TPSA | 66.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|