About butan-1-amine;propyl prop-2-enoate
butan-1-amine;propyl prop-2-enoate (PubChem CID 18325509) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is butan-1-amine;propyl prop-2-enoate.
Molecular Properties
| Compound Name | butan-1-amine;propyl prop-2-enoate |
| PubChem CID | 18325509 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | butan-1-amine;propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC.CCCCN |
| InChI | InChI=1S/C6H10O2.C4H11N/c1-3-5-8-6(7)4-2;1-2-3-4-5/h4H,2-3,5H2,1H3;2-5H2,1H3 |
| InChIKey | QNZKWWBSOSSURB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze butan-1-amine;propyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-amine;propyl prop-2-enoate?
The IUPAC name of butan-1-amine;propyl prop-2-enoate (CID 18325509) is butan-1-amine;propyl prop-2-enoate.
What is the SMILES notation for butan-1-amine;propyl prop-2-enoate?
The canonical SMILES for butan-1-amine;propyl prop-2-enoate is C=CC(=O)OCCC.CCCCN.
What is the InChIKey of butan-1-amine;propyl prop-2-enoate?
The InChIKey is QNZKWWBSOSSURB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.C4H11N/c1-3-5-8-6(7)4-2;1-2-3-4-5/h4H,2-3,5H2,1H3;2-5H2,1H3.
What are the key properties of butan-1-amine;propyl prop-2-enoate?
butan-1-amine;propyl prop-2-enoate has a molecular weight of 187.28 g/mol, XLogP of 1.87, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-amine;propyl prop-2-enoate is sourced from PubChem (CID 18325509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).