C13H15ClN4O3 — CID 18326535
2-chloro-6-nitro-N-(2-propoxyethyl)quinazolin-4-amine (PubChem CID 18326535) has the molecular formula C13H15ClN4O3 and a molecular weight of 310.74 g/mol. Its IUPAC name is 2-chloro-6-nitro-N-(2-propoxyethyl)quinazolin-4-amine.
| Compound Name | 2-chloro-6-nitro-N-(2-propoxyethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 18326535 |
| Molecular Formula | C13H15ClN4O3 |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-chloro-6-nitro-N-(2-propoxyethyl)quinazolin-4-amine |
| SMILES | CCCOCCNc1nc(Cl)nc2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C13H15ClN4O3/c1-2-6-21-7-5-15-12-10-8-9(18(19)20)3-4-11(10)16-13(14)17-12/h3-4,8H,2,5-7H2,1H3,(H,15,16,17) |
| InChIKey | CJHNVSWWWGHPIF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|