C23H21ClFNO6S — CID 18328197
2-[(5-but-3-yn-2-yloxy-4-chloro-2-fluorophenyl)-carboxycarbamoyl]cyclohexene-1-carboxylic acid;thiophene (PubChem CID 18328197) has the molecular formula C23H21ClFNO6S and a molecular weight of 493.94 g/mol. Its IUPAC name is 2-[(5-but-3-yn-2-yloxy-4-chloro-2-fluorophenyl)-carboxycarbamoyl]cyclohexene-1-carboxylic acid;thiophene.
| Compound Name | 2-[(5-but-3-yn-2-yloxy-4-chloro-2-fluorophenyl)-carboxycarbamoyl]cyclohexene-1-carboxylic acid;thiophene |
|---|---|
| PubChem CID | 18328197 |
| Molecular Formula | C23H21ClFNO6S |
| Molecular Weight | 493.94 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | 2-[(5-but-3-yn-2-yloxy-4-chloro-2-fluorophenyl)-carboxycarbamoyl]cyclohexene-1-carboxylic acid;thiophene |
| SMILES | C#CC(C)Oc1cc(N(C(=O)O)C(=O)C2=C(C(=O)O)CCCC2)c(F)cc1Cl.c1ccsc1 |
| InChI | InChI=1S/C19H17ClFNO6.C4H4S/c1-3-10(2)28-16-9-15(14(21)8-13(16)20)22(19(26)27)17(23)11-6-4-5-7-12(11)18(24)25;1-2-4-5-3-1/h1,8-10H,4-7H2,2H3,(H,24,25)(H,26,27);1-4H |
| InChIKey | JEEXQKLNDZAGNN-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.94 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|