C19H20Cl2FNO6 — CID 19096764
2-[(2-chloroacetyl)-[4-chloro-5-(ethoxymethoxy)-2-fluorophenyl]carbamoyl]cyclohexene-1-carboxylic acid (PubChem CID 19096764) has the molecular formula C19H20Cl2FNO6 and a molecular weight of 448.27 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-[4-chloro-5-(ethoxymethoxy)-2-fluorophenyl]carbamoyl]cyclohexene-1-carboxylic acid.
| Compound Name | 2-[(2-chloroacetyl)-[4-chloro-5-(ethoxymethoxy)-2-fluorophenyl]carbamoyl]cyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 19096764 |
| Molecular Formula | C19H20Cl2FNO6 |
| Molecular Weight | 448.27 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | 2-[(2-chloroacetyl)-[4-chloro-5-(ethoxymethoxy)-2-fluorophenyl]carbamoyl]cyclohexene-1-carboxylic acid |
| SMILES | CCOCOc1cc(N(C(=O)CCl)C(=O)C2=C(C(=O)O)CCCC2)c(F)cc1Cl |
| InChI | InChI=1S/C19H20Cl2FNO6/c1-2-28-10-29-16-8-15(14(22)7-13(16)21)23(17(24)9-20)18(25)11-5-3-4-6-12(11)19(26)27/h7-8H,2-6,9-10H2,1H3,(H,26,27) |
| InChIKey | NZAYXCSTMLAAJI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.27 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|