C24H28Cl2FNO7S — CID 18328362
2-ethoxyethyl 2-[(2-chloroacetyl)-[4-chloro-2-fluoro-5-(1-methoxy-1-oxopropan-2-yl)sulfanylphenyl]carbamoyl]cyclohexene-1-carboxylate (PubChem CID 18328362) has the molecular formula C24H28Cl2FNO7S and a molecular weight of 564.46 g/mol. Its IUPAC name is 2-ethoxyethyl 2-[(2-chloroacetyl)-[4-chloro-2-fluoro-5-(1-methoxy-1-oxopropan-2-yl)sulfanylphenyl]carbamoyl]cyclohexene-1-carboxylate.
| Compound Name | 2-ethoxyethyl 2-[(2-chloroacetyl)-[4-chloro-2-fluoro-5-(1-methoxy-1-oxopropan-2-yl)sulfanylphenyl]carbamoyl]cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 18328362 |
| Molecular Formula | C24H28Cl2FNO7S |
| Molecular Weight | 564.46 g/mol |
| Exact Mass | 563.09 |
| IUPAC Name | 2-ethoxyethyl 2-[(2-chloroacetyl)-[4-chloro-2-fluoro-5-(1-methoxy-1-oxopropan-2-yl)sulfanylphenyl]carbamoyl]cyclohexene-1-carboxylate |
| SMILES | CCOCCOC(=O)C1=C(C(=O)N(C(=O)CCl)c2cc(SC(C)C(=O)OC)c(Cl)cc2F)CCCC1 |
| InChI | InChI=1S/C24H28Cl2FNO7S/c1-4-34-9-10-35-24(32)16-8-6-5-7-15(16)22(30)28(21(29)13-25)19-12-20(17(26)11-18(19)27)36-14(2)23(31)33-3/h11-12,14H,4-10,13H2,1-3H3 |
| InChIKey | BLXDSGZALDXSME-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|