C30H33ClFNO6S — CID 18328281
propyl 2-[benzoyl-[5-(2-butoxy-2-oxoethyl)sulfanyl-4-chloro-2-fluorophenyl]carbamoyl]cyclohexene-1-carboxylate (PubChem CID 18328281) has the molecular formula C30H33ClFNO6S and a molecular weight of 590.11 g/mol. Its IUPAC name is propyl 2-[benzoyl-[5-(2-butoxy-2-oxoethyl)sulfanyl-4-chloro-2-fluorophenyl]carbamoyl]cyclohexene-1-carboxylate.
| Compound Name | propyl 2-[benzoyl-[5-(2-butoxy-2-oxoethyl)sulfanyl-4-chloro-2-fluorophenyl]carbamoyl]cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 18328281 |
| Molecular Formula | C30H33ClFNO6S |
| Molecular Weight | 590.11 g/mol |
| Exact Mass | 589.17 |
| IUPAC Name | propyl 2-[benzoyl-[5-(2-butoxy-2-oxoethyl)sulfanyl-4-chloro-2-fluorophenyl]carbamoyl]cyclohexene-1-carboxylate |
| SMILES | CCCCOC(=O)CSc1cc(N(C(=O)C2=C(C(=O)OCCC)CCCC2)C(=O)c2ccccc2)c(F)cc1Cl |
| InChI | InChI=1S/C30H33ClFNO6S/c1-3-5-16-38-27(34)19-40-26-18-25(24(32)17-23(26)31)33(28(35)20-11-7-6-8-12-20)29(36)21-13-9-10-14-22(21)30(37)39-15-4-2/h6-8,11-12,17-18H,3-5,9-10,13-16,19H2,1-2H3 |
| InChIKey | MZRPUTJXERUOPZ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.11 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|