C24H21ClFNO6S — CID 18328287
2-[benzoyl-[4-chloro-2-fluoro-5-(2-methoxy-2-oxoethyl)sulfanylphenyl]carbamoyl]cyclohexene-1-carboxylic acid (PubChem CID 18328287) has the molecular formula C24H21ClFNO6S and a molecular weight of 505.95 g/mol. Its IUPAC name is 2-[benzoyl-[4-chloro-2-fluoro-5-(2-methoxy-2-oxoethyl)sulfanylphenyl]carbamoyl]cyclohexene-1-carboxylic acid.
| Compound Name | 2-[benzoyl-[4-chloro-2-fluoro-5-(2-methoxy-2-oxoethyl)sulfanylphenyl]carbamoyl]cyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 18328287 |
| Molecular Formula | C24H21ClFNO6S |
| Molecular Weight | 505.95 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | 2-[benzoyl-[4-chloro-2-fluoro-5-(2-methoxy-2-oxoethyl)sulfanylphenyl]carbamoyl]cyclohexene-1-carboxylic acid |
| SMILES | COC(=O)CSc1cc(N(C(=O)C2=C(C(=O)O)CCCC2)C(=O)c2ccccc2)c(F)cc1Cl |
| InChI | InChI=1S/C24H21ClFNO6S/c1-33-21(28)13-34-20-12-19(18(26)11-17(20)25)27(22(29)14-7-3-2-4-8-14)23(30)15-9-5-6-10-16(15)24(31)32/h2-4,7-8,11-12H,5-6,9-10,13H2,1H3,(H,31,32) |
| InChIKey | BCXJTPUHSLLQMO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.95 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|