C29H30ClF2NO7S — CID 18328325
2-ethoxyethyl 2-[[4-chloro-5-(2-ethoxy-2-oxoethyl)sulfanyl-2-fluorophenyl]-(3-fluorobenzoyl)carbamoyl]cyclohexene-1-carboxylate (PubChem CID 18328325) has the molecular formula C29H30ClF2NO7S and a molecular weight of 610.08 g/mol. Its IUPAC name is 2-ethoxyethyl 2-[[4-chloro-5-(2-ethoxy-2-oxoethyl)sulfanyl-2-fluorophenyl]-(3-fluorobenzoyl)carbamoyl]cyclohexene-1-carboxylate.
| Compound Name | 2-ethoxyethyl 2-[[4-chloro-5-(2-ethoxy-2-oxoethyl)sulfanyl-2-fluorophenyl]-(3-fluorobenzoyl)carbamoyl]cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 18328325 |
| Molecular Formula | C29H30ClF2NO7S |
| Molecular Weight | 610.08 g/mol |
| Exact Mass | 609.14 |
| IUPAC Name | 2-ethoxyethyl 2-[[4-chloro-5-(2-ethoxy-2-oxoethyl)sulfanyl-2-fluorophenyl]-(3-fluorobenzoyl)carbamoyl]cyclohexene-1-carboxylate |
| SMILES | CCOCCOC(=O)C1=C(C(=O)N(C(=O)c2cccc(F)c2)c2cc(SCC(=O)OCC)c(Cl)cc2F)CCCC1 |
| InChI | InChI=1S/C29H30ClF2NO7S/c1-3-38-12-13-40-29(37)21-11-6-5-10-20(21)28(36)33(27(35)18-8-7-9-19(31)14-18)24-16-25(22(30)15-23(24)32)41-17-26(34)39-4-2/h7-9,14-16H,3-6,10-13,17H2,1-2H3 |
| InChIKey | YKLVCODLEFQQHS-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.08 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|