C27H28ClF2NO7S — CID 70165819
2-ethoxyethyl 2-[[4-chloro-5-(2-ethoxy-2-oxoethyl)-2-fluorothiophen-3-yl]-(3-fluorobenzoyl)carbamoyl]cyclohexene-1-carboxylate (PubChem CID 70165819) has the molecular formula C27H28ClF2NO7S and a molecular weight of 584.04 g/mol. Its IUPAC name is 2-ethoxyethyl 2-[[4-chloro-5-(2-ethoxy-2-oxoethyl)-2-fluorothiophen-3-yl]-(3-fluorobenzoyl)carbamoyl]cyclohexene-1-carboxylate.
| Compound Name | 2-ethoxyethyl 2-[[4-chloro-5-(2-ethoxy-2-oxoethyl)-2-fluorothiophen-3-yl]-(3-fluorobenzoyl)carbamoyl]cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 70165819 |
| Molecular Formula | C27H28ClF2NO7S |
| Molecular Weight | 584.04 g/mol |
| Exact Mass | 583.12 |
| IUPAC Name | 2-ethoxyethyl 2-[[4-chloro-5-(2-ethoxy-2-oxoethyl)-2-fluorothiophen-3-yl]-(3-fluorobenzoyl)carbamoyl]cyclohexene-1-carboxylate |
| SMILES | CCOCCOC(=O)C1=C(C(=O)N(C(=O)c2cccc(F)c2)c2c(F)sc(CC(=O)OCC)c2Cl)CCCC1 |
| InChI | InChI=1S/C27H28ClF2NO7S/c1-3-36-12-13-38-27(35)19-11-6-5-10-18(19)26(34)31(25(33)16-8-7-9-17(29)14-16)23-22(28)20(39-24(23)30)15-21(32)37-4-2/h7-9,14H,3-6,10-13,15H2,1-2H3 |
| InChIKey | STCOSZPAWIPEEH-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.04 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|