C20H23ClFNO7S — CID 70165788
ethoxymethyl 2-[acetyl-[4-chloro-2-fluoro-5-(2-methoxy-2-oxoethyl)thiophen-3-yl]carbamoyl]cyclohexene-1-carboxylate (PubChem CID 70165788) has the molecular formula C20H23ClFNO7S and a molecular weight of 475.92 g/mol. Its IUPAC name is ethoxymethyl 2-[acetyl-[4-chloro-2-fluoro-5-(2-methoxy-2-oxoethyl)thiophen-3-yl]carbamoyl]cyclohexene-1-carboxylate.
| Compound Name | ethoxymethyl 2-[acetyl-[4-chloro-2-fluoro-5-(2-methoxy-2-oxoethyl)thiophen-3-yl]carbamoyl]cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 70165788 |
| Molecular Formula | C20H23ClFNO7S |
| Molecular Weight | 475.92 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | ethoxymethyl 2-[acetyl-[4-chloro-2-fluoro-5-(2-methoxy-2-oxoethyl)thiophen-3-yl]carbamoyl]cyclohexene-1-carboxylate |
| SMILES | CCOCOC(=O)C1=C(C(=O)N(C(C)=O)c2c(F)sc(CC(=O)OC)c2Cl)CCCC1 |
| InChI | InChI=1S/C20H23ClFNO7S/c1-4-29-10-30-20(27)13-8-6-5-7-12(13)19(26)23(11(2)24)17-16(21)14(31-18(17)22)9-15(25)28-3/h4-10H2,1-3H3 |
| InChIKey | VSGFILPACKEAQI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.92 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|