C26H27ClFNO7S — CID 70164629
2-ethoxyethyl 2-[benzoyl-[4-chloro-2-fluoro-5-(2-methoxy-2-oxoethyl)thiophen-3-yl]carbamoyl]cyclohexene-1-carboxylate (PubChem CID 70164629) has the molecular formula C26H27ClFNO7S and a molecular weight of 552.02 g/mol. Its IUPAC name is 2-ethoxyethyl 2-[benzoyl-[4-chloro-2-fluoro-5-(2-methoxy-2-oxoethyl)thiophen-3-yl]carbamoyl]cyclohexene-1-carboxylate.
| Compound Name | 2-ethoxyethyl 2-[benzoyl-[4-chloro-2-fluoro-5-(2-methoxy-2-oxoethyl)thiophen-3-yl]carbamoyl]cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 70164629 |
| Molecular Formula | C26H27ClFNO7S |
| Molecular Weight | 552.02 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | 2-ethoxyethyl 2-[benzoyl-[4-chloro-2-fluoro-5-(2-methoxy-2-oxoethyl)thiophen-3-yl]carbamoyl]cyclohexene-1-carboxylate |
| SMILES | CCOCCOC(=O)C1=C(C(=O)N(C(=O)c2ccccc2)c2c(F)sc(CC(=O)OC)c2Cl)CCCC1 |
| InChI | InChI=1S/C26H27ClFNO7S/c1-3-35-13-14-36-26(33)18-12-8-7-11-17(18)25(32)29(24(31)16-9-5-4-6-10-16)22-21(27)19(37-23(22)28)15-20(30)34-2/h4-6,9-10H,3,7-8,11-15H2,1-2H3 |
| InChIKey | KKRKZFZQJBIRTC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.02 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|