C28H30ClF2NO6S — CID 70165027
pentyl 2-[[4-chloro-5-(2-ethoxy-2-oxoethyl)-2-fluorothiophen-3-yl]-(3-fluorobenzoyl)carbamoyl]cyclohexene-1-carboxylate (PubChem CID 70165027) has the molecular formula C28H30ClF2NO6S and a molecular weight of 582.07 g/mol. Its IUPAC name is pentyl 2-[[4-chloro-5-(2-ethoxy-2-oxoethyl)-2-fluorothiophen-3-yl]-(3-fluorobenzoyl)carbamoyl]cyclohexene-1-carboxylate.
| Compound Name | pentyl 2-[[4-chloro-5-(2-ethoxy-2-oxoethyl)-2-fluorothiophen-3-yl]-(3-fluorobenzoyl)carbamoyl]cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 70165027 |
| Molecular Formula | C28H30ClF2NO6S |
| Molecular Weight | 582.07 g/mol |
| Exact Mass | 581.15 |
| IUPAC Name | pentyl 2-[[4-chloro-5-(2-ethoxy-2-oxoethyl)-2-fluorothiophen-3-yl]-(3-fluorobenzoyl)carbamoyl]cyclohexene-1-carboxylate |
| SMILES | CCCCCOC(=O)C1=C(C(=O)N(C(=O)c2cccc(F)c2)c2c(F)sc(CC(=O)OCC)c2Cl)CCCC1 |
| InChI | InChI=1S/C28H30ClF2NO6S/c1-3-5-8-14-38-28(36)20-13-7-6-12-19(20)27(35)32(26(34)17-10-9-11-18(30)15-17)24-23(29)21(39-25(24)31)16-22(33)37-4-2/h9-11,15H,3-8,12-14,16H2,1-2H3 |
| InChIKey | HOSPJOGVCMFCNU-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.07 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|