C16H13Cl2FN2O3 — CID 110193056
(6S,7aS)-2-(5-but-3-yn-2-yloxy-4-chloro-2-fluorophenyl)-6-chloro-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione (PubChem CID 110193056) has the molecular formula C16H13Cl2FN2O3 and a molecular weight of 371.20 g/mol. Its IUPAC name is (6S,7aS)-2-(5-but-3-yn-2-yloxy-4-chloro-2-fluorophenyl)-6-chloro-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione.
| Compound Name | (6S,7aS)-2-(5-but-3-yn-2-yloxy-4-chloro-2-fluorophenyl)-6-chloro-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
|---|---|
| PubChem CID | 110193056 |
| Molecular Formula | C16H13Cl2FN2O3 |
| Molecular Weight | 371.20 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | (6S,7aS)-2-(5-but-3-yn-2-yloxy-4-chloro-2-fluorophenyl)-6-chloro-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
| SMILES | C#CC(C)Oc1cc(N2C(=O)[C@@H]3C[C@H](Cl)CN3C2=O)c(F)cc1Cl |
| InChI | InChI=1S/C16H13Cl2FN2O3/c1-3-8(2)24-14-6-12(11(19)5-10(14)18)21-15(22)13-4-9(17)7-20(13)16(21)23/h1,5-6,8-9,13H,4,7H2,2H3/t8?,9-,13-/m0/s1 |
| InChIKey | MGHAKUOEIMUNKU-JDRUZZMFSA-N |
| XLogP | 3.03 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.20 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|